Amonafide
| Compound Structure: |
.png)
|
||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Synonyms: | Amonafide;Nafidimide;Quinamed;Benzisoquinolinedione;Xanafide;5-Aminomitonafide;NSC-308847;AS1413;AS-1413(Amonafide);M-FA 142;3-Amino-N-(2-(dimethylamino)ethyl)naphthalimide;5-amino-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione | ||||||||||||||||||||||||||||||||||||||
| Compound ID: | NMPC-583 | ||||||||||||||||||||||||||||||||||||||
| PubChem ID: | |||||||||||||||||||||||||||||||||||||||
| Molecular Formula: | C16H17N3O2 | ||||||||||||||||||||||||||||||||||||||
| Canonical SMILES: | CN(C)CCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)N | ||||||||||||||||||||||||||||||||||||||
| InChIKey: | UPALIKSFLSVKIS-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||
| About the compound: | Amonafide is a chemotherapeutic drug that has been studied for its potential use in the treatment of cancer. Here's an overview of its properties and development: Chemical Structure: Amonafide is classified as an imide derivative of naphthalic acid. Its chemical structure is characterized by a naphthalene ring with imide groups. Mechanism of Action: DNA Intercalation: Amonafide is known for its ability to intercalate into DNA. This means it can insert itself between the base pairs of DNA, disrupting the normal DNA structure. Topoisomerase II Inhibition: Amonafide is also an inhibitor of topoisomerase II, an enzyme involved in DNA replication and repair. Inhibition of this enzyme can lead to the formation of protein-associated strand breaks in DNA. Potential as a Cancer Treatment: Amonafide belongs to the family of drugs called topoisomerase inhibitors and intercalating agents. These drugs are known for their ability to interfere with DNA processes in cancer cells. By intercalating into DNA and inhibiting topoisomerase II, amonafide disrupts DNA replication and RNA synthesis in cancer cells, ultimately leading to cell death. Clinical Development: Amonafide was developed as a potential anti-cancer therapy by the pharmaceutical company Antisoma. It has undergone clinical trials to evaluate its safety and efficacy in cancer treatment. As of 2008, it had reached Phase III clinical trials, including trials against secondary acute myeloid leukemia (AML). In June 2010, it gained Fast Track Status from the U.S. Food and Drug Administration (FDA) for the treatment of Secondary Acute Myeloid Leukemia. The mechanism of action of amonafide, particularly its ability to intercalate into DNA and inhibit topoisomerase II, makes it a promising candidate for cancer therapy. Clinical trials aim to assess its effectiveness and safety in treating various types of cancer, including leukemia. |
||||||||||||||||||||||||||||||||||||||
| Properties: |
Chemical
and Physical Properties Computed
Properties
Source:
PubChem |
||||||||||||||||||||||||||||||||||||||
| Source Species: |
Hibiscus asper |