3,5-O-dicaffeoylquinic acid
| Compound Structure: |
.png)
|
||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Synonyms: | Isochlorogenic acid A;3,5-Dicaffeoylquinic acid;2450-53-5;3,5-Di-O-caffeoylquinic acid;89919-62-0;3,5-DCQA;3,5-Dicaffeoyl-epi-quinic acid;Quinic acid 3,5-di-O-caffeate;(3R,5R)-3,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,4-dihydroxycyclohexane- | ||||||||||||||||||||||||||||||||||||||
| Compound ID: | NMPC-320 | ||||||||||||||||||||||||||||||||||||||
| PubChem ID: | |||||||||||||||||||||||||||||||||||||||
| Molecular Formula: | C25H24O12 | ||||||||||||||||||||||||||||||||||||||
| Canonical SMILES: | C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O | ||||||||||||||||||||||||||||||||||||||
| InChIKey: | KRZBCHWVBQOTNZ-RDJMKVHDSA-N | ||||||||||||||||||||||||||||||||||||||
| About the compound: | 3,5-di-O-caffeoyl quinic acid, also known as Isochlorogenic acid A, is a carboxylic ester compound with notable biological activities. Here are some key points about it: This compound is a diester formed through the condensation of the hydroxy groups at positions 3 and 5 of (-)-quinic acid with the carboxy group of trans-caffeic acid. Its structure reflects its derivation from quinic acid and caffeic acid. Isochlorogenic acid A is found in various natural sources, including Brazilian propolis and Suaeda glauca. It is one of the constituents of these natural materials. Isochlorogenic acid A exhibits hepatoprotective properties, meaning it can help protect the liver from damage or injury. It also displays cytotoxic activities, indicating its potential to induce cell death in certain contexts. As an antineoplastic agent, it may have properties that can inhibit or slow the growth of cancer cells. Isochlorogenic acid A is classified as a cyclitol carboxylic acid. Cyclitols are a group of cyclic polyols, which are sugar alcohols that contain multiple hydroxyl groups. In this case, it is combined with carboxylic acid functionalities. It is functionally related to (-)-quinic acid and trans-caffeic acid due to its formation from these precursor molecules. Overall, Isochlorogenic acid A is a natural compound with various biological activities, making it potentially valuable in the fields of medicine and health. Its presence in Brazilian propolis and other natural sources highlights its role in traditional medicine and potential for further research in modern medicine and pharmacology. |
||||||||||||||||||||||||||||||||||||||
| Properties: |
Chemical
and Physical Properties
Source: PubChem |
||||||||||||||||||||||||||||||||||||||
| Source Species: |
Macaranga barteri Newbouldia laevis |