(20S, 24R)-Epoxydammarane-3β, 25-diol
| Compound Structure: |
-Epoxydammarane-3β, 25-diol.png)
|
||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Synonyms: | 3-Dehydropyxinol;20S,24R-Epoxydammar-12,25-diol-3-one;(20S)-Protopanaxadiol metabolite M2-2;(20S,24R)-12beta,25-Dihydroxy-20,24-epoxydammaran-3-one; (12beta,24R)-20,24-Epoxy-12,25-dihydroxydammaran-3-one; Dammaran-3-one, 20,24-epoxy-12,25-dihydroxy-, (12b | ||||||||||||||||||||||||||||||||||||||
| Compound ID: | NMPC-020 | ||||||||||||||||||||||||||||||||||||||
| PubChem ID: | |||||||||||||||||||||||||||||||||||||||
| Molecular Formula: | C30H50O4 | ||||||||||||||||||||||||||||||||||||||
| Canonical SMILES: | CC1(C2CCC3(C(C2(CCC1=O)C)CC(C4C3(CCC4C5(CCC(O5)C(C)(C)O)C)C)O)C)C | ||||||||||||||||||||||||||||||||||||||
| InChIKey: | MOCDJPYINJXPKU-BDSQRYQESA-N | ||||||||||||||||||||||||||||||||||||||
| About the compound: | This
molecule belongs to the dammarane family of triterpenoids, which is a type of
naturally occurring organic compound characterized by a four-ring structure.
The "epoxy" indicates an oxygen bridge between two carbon atoms, and
"diol" indicates the presence of two alcohol (-OH) groups. The
specific stereochemistry is indicated by the "20S, 24R"
configuration. Triterpenoids like the one mentioned are typically found in
various plants, especially in resins and saps of trees. Dammarane
triterpenoids, for example, are commonly found in the sap of trees in the
Dipterocarpaceae family, which produce dammar resin. Some dammarane
triterpenoids are also found in certain medicinal herbs, notably ginseng. Many
triterpenoids, including various dammarane types, have been used in traditional
medicines across different cultures. Their potential therapeutic effects range
from anti-inflammatory to anti-tumor activities. |
||||||||||||||||||||||||||||||||||||||
| Properties: |
Chemical and Physical Properties
Source: PubChem |
||||||||||||||||||||||||||||||||||||||
| Source Species: |
Ficus thonningii |